C18H13Cl2N3O6S2 — CID 22202678
N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide (PubChem CID 22202678) has the molecular formula C18H13Cl2N3O6S2 and a molecular weight of 502.36 g/mol. Its IUPAC name is N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 22202678 |
| Molecular Formula | C18H13Cl2N3O6S2 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 500.96 |
| IUPAC Name | N-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C18H13Cl2N3O6S2/c19-17-9-6-13(10-18(17)20)22-30(26,27)15-7-4-12(5-8-15)21-31(28,29)16-3-1-2-14(11-16)23(24)25/h1-11,21-22H |
| InChIKey | ONMIXZAAAKVSCC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|