C12H7Cl2NO4S — CID 154259440
1,2-dichloro-4-(3-nitrophenyl)sulfonylbenzene (PubChem CID 154259440) has the molecular formula C12H7Cl2NO4S and a molecular weight of 332.16 g/mol. Its IUPAC name is 1,2-dichloro-4-(3-nitrophenyl)sulfonylbenzene.
| Compound Name | 1,2-dichloro-4-(3-nitrophenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 154259440 |
| Molecular Formula | C12H7Cl2NO4S |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 1,2-dichloro-4-(3-nitrophenyl)sulfonylbenzene |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H7Cl2NO4S/c13-11-5-4-10(7-12(11)14)20(18,19)9-3-1-2-8(6-9)15(16)17/h1-7H |
| InChIKey | SEBFPZPJGCGEBL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|