About (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate
(3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate (PubChem CID 14245606) has the molecular formula C12H8N2O10S2
and a molecular weight of 404.33 g/mol. Its IUPAC name is (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate |
| PubChem CID | 14245606 |
| Molecular Formula | C12H8N2O10S2 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)OOS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C12H8N2O10S2/c15-13(16)9-3-1-5-11(7-9)25(19,20)23-24-26(21,22)12-6-2-4-10(8-12)14(17)18/h1-8H |
| InChIKey | HTFPLYQUBPPUPL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate?
The IUPAC name of (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate (CID 14245606) is (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate.
What is the SMILES notation for (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate?
The canonical SMILES for (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate is O=[N+]([O-])c1cccc(S(=O)(=O)OOS(=O)(=O)c2cccc([N+](=O)[O-])c2)c1.
What is the InChIKey of (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate?
The InChIKey is HTFPLYQUBPPUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O10S2/c15-13(16)9-3-1-5-11(7-9)25(19,20)23-24-26(21,22)12-6-2-4-10(8-12)14(17)18/h1-8H.
What are the key properties of (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate?
(3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate has a molecular weight of 404.33 g/mol, XLogP of 1.53, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl)sulfonyloxy 3-nitrobenzenesulfonate is sourced from PubChem (CID 14245606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).