C8H6FN3O9S — CID 4641931
(2-fluoro-2,2-dinitroethyl) 3-nitrobenzenesulfonate (PubChem CID 4641931) has the molecular formula C8H6FN3O9S and a molecular weight of 339.21 g/mol. Its IUPAC name is (2-fluoro-2,2-dinitroethyl) 3-nitrobenzenesulfonate.
| Compound Name | (2-fluoro-2,2-dinitroethyl) 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 4641931 |
| Molecular Formula | C8H6FN3O9S |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | (2-fluoro-2,2-dinitroethyl) 3-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)OCC(F)([N+](=O)[O-])[N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H6FN3O9S/c9-8(11(15)16,12(17)18)5-21-22(19,20)7-3-1-2-6(4-7)10(13)14/h1-4H,5H2 |
| InChIKey | QPDKVOQKTUAOGL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 172.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|