C8H6F2N2O9S2 — CID 4714066
(2-fluoro-2,2-dinitroethyl) 3-fluorosulfonylbenzenesulfonate (PubChem CID 4714066) has the molecular formula C8H6F2N2O9S2 and a molecular weight of 376.27 g/mol. Its IUPAC name is (2-fluoro-2,2-dinitroethyl) 3-fluorosulfonylbenzenesulfonate.
| Compound Name | (2-fluoro-2,2-dinitroethyl) 3-fluorosulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 4714066 |
| Molecular Formula | C8H6F2N2O9S2 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | (2-fluoro-2,2-dinitroethyl) 3-fluorosulfonylbenzenesulfonate |
| SMILES | O=[N+]([O-])C(F)(COS(=O)(=O)c1cccc(S(=O)(=O)F)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H6F2N2O9S2/c9-8(11(13)14,12(15)16)5-21-23(19,20)7-3-1-2-6(4-7)22(10,17)18/h1-4H,5H2 |
| InChIKey | KCVGLVFQGGATBE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 163.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|