C9H5ClF6O3S — CID 134017333
2,2,2-trifluoroethyl 4-chloro-3-(trifluoromethyl)benzenesulfonate (PubChem CID 134017333) has the molecular formula C9H5ClF6O3S and a molecular weight of 342.64 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-chloro-3-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2,2,2-trifluoroethyl 4-chloro-3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 134017333 |
| Molecular Formula | C9H5ClF6O3S |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-chloro-3-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)F)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5ClF6O3S/c10-7-2-1-5(3-6(7)9(14,15)16)20(17,18)19-4-8(11,12)13/h1-3H,4H2 |
| InChIKey | YLIXGALJPGLIOH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|