C12H15F3O3S — CID 134017335
2,2,2-trifluoroethyl 4-tert-butylbenzenesulfonate (PubChem CID 134017335) has the molecular formula C12H15F3O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-tert-butylbenzenesulfonate.
| Compound Name | 2,2,2-trifluoroethyl 4-tert-butylbenzenesulfonate |
|---|---|
| PubChem CID | 134017335 |
| Molecular Formula | C12H15F3O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-tert-butylbenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O3S/c1-11(2,3)9-4-6-10(7-5-9)19(16,17)18-8-12(13,14)15/h4-7H,8H2,1-3H3 |
| InChIKey | QZOQTCLJYXDYKD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|