C12H18O4S — CID 169441339
2-hydroxyethyl 4-tert-butylbenzenesulfonate (PubChem CID 169441339) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-hydroxyethyl 4-tert-butylbenzenesulfonate.
| Compound Name | 2-hydroxyethyl 4-tert-butylbenzenesulfonate |
|---|---|
| PubChem CID | 169441339 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-hydroxyethyl 4-tert-butylbenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)OCCO)cc1 |
| InChI | InChI=1S/C12H18O4S/c1-12(2,3)10-4-6-11(7-5-10)17(14,15)16-9-8-13/h4-7,13H,8-9H2,1-3H3 |
| InChIKey | ARDSRDQZZGQKRH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|