C11H16O4S3 — CID 102514868
2-(2-hydroxyethyldisulfanyl)ethyl 4-methylbenzenesulfonate (PubChem CID 102514868) has the molecular formula C11H16O4S3 and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-(2-hydroxyethyldisulfanyl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2-hydroxyethyldisulfanyl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102514868 |
| Molecular Formula | C11H16O4S3 |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-(2-hydroxyethyldisulfanyl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCSSCCO)cc1 |
| InChI | InChI=1S/C11H16O4S3/c1-10-2-4-11(5-3-10)18(13,14)15-7-9-17-16-8-6-12/h2-5,12H,6-9H2,1H3 |
| InChIKey | GJNYSBAUKADEHY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|