C14H23NO4S2 — CID 121315050
2-[1-hydroxy-1-(propan-2-ylamino)ethyl]sulfanylethyl 4-methylbenzenesulfonate (PubChem CID 121315050) has the molecular formula C14H23NO4S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-[1-hydroxy-1-(propan-2-ylamino)ethyl]sulfanylethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[1-hydroxy-1-(propan-2-ylamino)ethyl]sulfanylethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 121315050 |
| Molecular Formula | C14H23NO4S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[1-hydroxy-1-(propan-2-ylamino)ethyl]sulfanylethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCSC(C)(O)NC(C)C)cc1 |
| InChI | InChI=1S/C14H23NO4S2/c1-11(2)15-14(4,16)20-10-9-19-21(17,18)13-7-5-12(3)6-8-13/h5-8,11,15-16H,9-10H2,1-4H3 |
| InChIKey | XAHZGRPDDZCAKL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|