C16H23NO4S2 — CID 121315186
2-(cyclohexylcarbamoylsulfanyl)ethyl 4-methylbenzenesulfonate (PubChem CID 121315186) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoylsulfanyl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(cyclohexylcarbamoylsulfanyl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 121315186 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(cyclohexylcarbamoylsulfanyl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCSC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H23NO4S2/c1-13-7-9-15(10-8-13)23(19,20)21-11-12-22-16(18)17-14-5-3-2-4-6-14/h7-10,14H,2-6,11-12H2,1H3,(H,17,18) |
| InChIKey | AJPDXNYKCAUJHY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|