C33H36O12S3 — CID 10723571
2-[3,5-bis[2-(4-methylphenyl)sulfonyloxyethoxy]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 10723571) has the molecular formula C33H36O12S3 and a molecular weight of 720.84 g/mol. Its IUPAC name is 2-[3,5-bis[2-(4-methylphenyl)sulfonyloxyethoxy]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3,5-bis[2-(4-methylphenyl)sulfonyloxyethoxy]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10723571 |
| Molecular Formula | C33H36O12S3 |
| Molecular Weight | 720.84 g/mol |
| Exact Mass | 720.14 |
| IUPAC Name | 2-[3,5-bis[2-(4-methylphenyl)sulfonyloxyethoxy]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2cc(OCCOS(=O)(=O)c3ccc(C)cc3)cc(OCCOS(=O)(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C33H36O12S3/c1-25-4-10-31(11-5-25)46(34,35)43-19-16-40-28-22-29(41-17-20-44-47(36,37)32-12-6-26(2)7-13-32)24-30(23-28)42-18-21-45-48(38,39)33-14-8-27(3)9-15-33/h4-15,22-24H,16-21H2,1-3H3 |
| InChIKey | GBMFZNKBRAPOTF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|