C15H15ClO4S — CID 11823601
2-(2-chlorophenoxy)ethyl 4-methylbenzenesulfonate (PubChem CID 11823601) has the molecular formula C15H15ClO4S and a molecular weight of 326.80 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2-chlorophenoxy)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11823601 |
| Molecular Formula | C15H15ClO4S |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H15ClO4S/c1-12-6-8-13(9-7-12)21(17,18)20-11-10-19-15-5-3-2-4-14(15)16/h2-9H,10-11H2,1H3 |
| InChIKey | DKFYCKUSWAIVBA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|