C17H17F3O5S — CID 71573480
2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 71573480) has the molecular formula C17H17F3O5S and a molecular weight of 390.38 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71573480 |
| Molecular Formula | C17H17F3O5S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccccc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3O5S/c1-13-6-8-14(9-7-13)26(21,22)25-11-10-23-15-4-2-3-5-16(15)24-12-17(18,19)20/h2-9H,10-12H2,1H3 |
| InChIKey | HWAQLPSTWBJMTM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|