C26H30O9S3 — CID 71676369
[2-(benzenesulfonyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate (PubChem CID 71676369) has the molecular formula C26H30O9S3 and a molecular weight of 582.72 g/mol. Its IUPAC name is [2-(benzenesulfonyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(benzenesulfonyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71676369 |
| Molecular Formula | C26H30O9S3 |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | [2-(benzenesulfonyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]butyl] 4-methylbenzenesulfonate |
| SMILES | CCC(COS(=O)(=O)c1ccccc1)(COS(=O)(=O)c1ccc(C)cc1)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H30O9S3/c1-4-26(18-33-36(27,28)23-8-6-5-7-9-23,19-34-37(29,30)24-14-10-21(2)11-15-24)20-35-38(31,32)25-16-12-22(3)13-17-25/h5-17H,4,18-20H2,1-3H3 |
| InChIKey | USSIEDFIXXROFR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|