C22H28O6S2 — CID 87536862
[2-ethyl-2-[(4-methylphenyl)sulfonyloxymethyl]pent-4-enyl] 4-methylbenzenesulfonate (PubChem CID 87536862) has the molecular formula C22H28O6S2 and a molecular weight of 452.59 g/mol. Its IUPAC name is [2-ethyl-2-[(4-methylphenyl)sulfonyloxymethyl]pent-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethyl-2-[(4-methylphenyl)sulfonyloxymethyl]pent-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87536862 |
| Molecular Formula | C22H28O6S2 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [2-ethyl-2-[(4-methylphenyl)sulfonyloxymethyl]pent-4-enyl] 4-methylbenzenesulfonate |
| SMILES | C=CCC(CC)(COS(=O)(=O)c1ccc(C)cc1)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H28O6S2/c1-5-15-22(6-2,16-27-29(23,24)20-11-7-18(3)8-12-20)17-28-30(25,26)21-13-9-19(4)10-14-21/h5,7-14H,1,6,15-17H2,2-4H3 |
| InChIKey | JRPRSLRZQCCUDT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|