C23H32O6S2 — CID 84820678
[2,2,4,4-tetramethyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate (PubChem CID 84820678) has the molecular formula C23H32O6S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is [2,2,4,4-tetramethyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2,4,4-tetramethyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 84820678 |
| Molecular Formula | C23H32O6S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | [2,2,4,4-tetramethyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)CC(C)(C)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H32O6S2/c1-18-7-11-20(12-8-18)30(24,25)28-16-22(3,4)15-23(5,6)17-29-31(26,27)21-13-9-19(2)10-14-21/h7-14H,15-17H2,1-6H3 |
| InChIKey | LXAVYSZWVNVOGC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|