C21H28O7S2 — CID 146296864
[3-methoxy-3-methyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate (PubChem CID 146296864) has the molecular formula C21H28O7S2 and a molecular weight of 456.58 g/mol. Its IUPAC name is [3-methoxy-3-methyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [3-methoxy-3-methyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 146296864 |
| Molecular Formula | C21H28O7S2 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [3-methoxy-3-methyl-5-(4-methylphenyl)sulfonyloxypentyl] 4-methylbenzenesulfonate |
| SMILES | COC(C)(CCOS(=O)(=O)c1ccc(C)cc1)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H28O7S2/c1-17-5-9-19(10-6-17)29(22,23)27-15-13-21(3,26-4)14-16-28-30(24,25)20-11-7-18(2)8-12-20/h5-12H,13-16H2,1-4H3 |
| InChIKey | RFPZCPARCWOCOD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|