C21H28O6S2 — CID 139639337
[3-methyl-3-(4-propylsulfonylphenoxy)butyl] 4-methylbenzenesulfonate (PubChem CID 139639337) has the molecular formula C21H28O6S2 and a molecular weight of 440.58 g/mol. Its IUPAC name is [3-methyl-3-(4-propylsulfonylphenoxy)butyl] 4-methylbenzenesulfonate.
| Compound Name | [3-methyl-3-(4-propylsulfonylphenoxy)butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139639337 |
| Molecular Formula | C21H28O6S2 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [3-methyl-3-(4-propylsulfonylphenoxy)butyl] 4-methylbenzenesulfonate |
| SMILES | CCCS(=O)(=O)c1ccc(OC(C)(C)CCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H28O6S2/c1-5-16-28(22,23)19-12-8-18(9-13-19)27-21(3,4)14-15-26-29(24,25)20-10-6-17(2)7-11-20/h6-13H,5,14-16H2,1-4H3 |
| InChIKey | VFFCZLHPLOTWOY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|