About (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate
(5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate (PubChem CID 20578043) has the molecular formula C17H28O3S
and a molecular weight of 312.47 g/mol. Its IUPAC name is (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate |
| PubChem CID | 20578043 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate |
| SMILES | CCC(C)(CC)CCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H28O3S/c1-5-17(4,6-2)13-7-8-14-20-21(18,19)16-11-9-15(3)10-12-16/h9-12H,5-8,13-14H2,1-4H3 |
| InChIKey | IBSRMGIQNAGRKO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate?
The IUPAC name of (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate (CID 20578043) is (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate.
What is the SMILES notation for (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate?
The canonical SMILES for (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate is CCC(C)(CC)CCCCOS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate?
The InChIKey is IBSRMGIQNAGRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3S/c1-5-17(4,6-2)13-7-8-14-20-21(18,19)16-11-9-15(3)10-12-16/h9-12H,5-8,13-14H2,1-4H3.
What are the key properties of (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate?
(5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate has a molecular weight of 312.47 g/mol, XLogP of 4.70, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-5-methylheptyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 20578043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).