C13H15F5O3S — CID 139711244
5,5,6,6,6-pentafluorohexyl 4-methylbenzenesulfonate (PubChem CID 139711244) has the molecular formula C13H15F5O3S and a molecular weight of 346.32 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluorohexyl 4-methylbenzenesulfonate.
| Compound Name | 5,5,6,6,6-pentafluorohexyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139711244 |
| Molecular Formula | C13H15F5O3S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5,5,6,6,6-pentafluorohexyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F5O3S/c1-10-4-6-11(7-5-10)22(19,20)21-9-3-2-8-12(14,15)13(16,17)18/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | ZLVNLISJEXONKV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|