C18H25F3O4S — CID 90276509
(11,11,11-trifluoro-8-oxoundecyl) 4-methylbenzenesulfonate (PubChem CID 90276509) has the molecular formula C18H25F3O4S and a molecular weight of 394.46 g/mol. Its IUPAC name is (11,11,11-trifluoro-8-oxoundecyl) 4-methylbenzenesulfonate.
| Compound Name | (11,11,11-trifluoro-8-oxoundecyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90276509 |
| Molecular Formula | C18H25F3O4S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (11,11,11-trifluoro-8-oxoundecyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCC(=O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3O4S/c1-15-8-10-17(11-9-15)26(23,24)25-14-6-4-2-3-5-7-16(22)12-13-18(19,20)21/h8-11H,2-7,12-14H2,1H3 |
| InChIKey | YNBAUIQDJDYTNK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|