C10H9F2O5S- — CID 164747573
2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 164747573) has the molecular formula C10H9F2O5S- and a molecular weight of 279.24 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | 2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 164747573 |
| Molecular Formula | C10H9F2O5S- |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2,2-difluoro-3-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)C(=O)[O-])cc1 |
| InChI | InChI=1S/C10H10F2O5S/c1-7-2-4-8(5-3-7)18(15,16)17-6-10(11,12)9(13)14/h2-5H,6H2,1H3,(H,13,14)/p-1 |
| InChIKey | USBUFLGQCQHFDT-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|