C12H9ClF6O3S — CID 85346417
[3-chloro-4,4,4-trifluoro-2-(trifluoromethyl)but-2-enyl] 4-methylbenzenesulfonate (PubChem CID 85346417) has the molecular formula C12H9ClF6O3S and a molecular weight of 382.71 g/mol. Its IUPAC name is [3-chloro-4,4,4-trifluoro-2-(trifluoromethyl)but-2-enyl] 4-methylbenzenesulfonate.
| Compound Name | [3-chloro-4,4,4-trifluoro-2-(trifluoromethyl)but-2-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 85346417 |
| Molecular Formula | C12H9ClF6O3S |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [3-chloro-4,4,4-trifluoro-2-(trifluoromethyl)but-2-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=C(Cl)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9ClF6O3S/c1-7-2-4-8(5-3-7)23(20,21)22-6-9(11(14,15)16)10(13)12(17,18)19/h2-5H,6H2,1H3 |
| InChIKey | KDBUWTDWUZNWPT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|