C15H9F5O5S — CID 137375214
(2,3,4,5,6-pentafluorophenyl) 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 137375214) has the molecular formula C15H9F5O5S and a molecular weight of 396.29 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 137375214 |
| Molecular Formula | C15H9F5O5S |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H9F5O5S/c1-7-2-4-8(5-3-7)26(22,23)24-6-9(21)25-15-13(19)11(17)10(16)12(18)14(15)20/h2-5H,6H2,1H3 |
| InChIKey | NBDBTUFOXPNEBS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|