C20H32O9S — CID 170395974
2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 170395974) has the molecular formula C20H32O9S and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 170395974 |
| Molecular Formula | C20H32O9S |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)COCCOCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H32O9S/c1-18-3-5-20(6-4-18)30(22,23)29-16-15-27-12-11-25-8-7-24-9-10-26-13-14-28-17-19(2)21/h3-6H,7-17H2,1-2H3 |
| InChIKey | OUDFZTBZAMSYOV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|