C22H32O10S2 — CID 159030358
2-(2-hydroxyethoxy)ethanol;2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 159030358) has the molecular formula C22H32O10S2 and a molecular weight of 520.62 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159030358 |
| Molecular Formula | C22H32O10S2 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1.OCCOCCO |
| InChI | InChI=1S/C18H22O7S2.C4H10O3/c1-15-3-7-17(8-4-15)26(19,20)24-13-11-23-12-14-25-27(21,22)18-9-5-16(2)6-10-18;5-1-3-7-4-2-6/h3-10H,11-14H2,1-2H3;5-6H,1-4H2 |
| InChIKey | JUUQYBNCUDVIBB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|