C22H31NO8S2 — CID 15760434
2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethylamino]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 15760434) has the molecular formula C22H31NO8S2 and a molecular weight of 501.62 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethylamino]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethylamino]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15760434 |
| Molecular Formula | C22H31NO8S2 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethylamino]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCNCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H31NO8S2/c1-19-3-7-21(8-4-19)32(24,25)30-17-15-28-13-11-23-12-14-29-16-18-31-33(26,27)22-9-5-20(2)6-10-22/h3-10,23H,11-18H2,1-2H3 |
| InChIKey | DPEIDLZPVQCZTM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|