C42H54O15S3 — CID 10328359
2-[2-[[3,5-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]phenyl]methoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 10328359) has the molecular formula C42H54O15S3 and a molecular weight of 895.08 g/mol. Its IUPAC name is 2-[2-[[3,5-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]phenyl]methoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[[3,5-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]phenyl]methoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10328359 |
| Molecular Formula | C42H54O15S3 |
| Molecular Weight | 895.08 g/mol |
| Exact Mass | 894.26 |
| IUPAC Name | 2-[2-[[3,5-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]phenyl]methoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCc2cc(COCCOCCOS(=O)(=O)c3ccc(C)cc3)cc(COCCOCCOS(=O)(=O)c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C42H54O15S3/c1-34-4-10-40(11-5-34)58(43,44)55-25-22-49-16-19-52-31-37-28-38(32-53-20-17-50-23-26-56-59(45,46)41-12-6-35(2)7-13-41)30-39(29-37)33-54-21-18-51-24-27-57-60(47,48)42-14-8-36(3)9-15-42/h4-15,28-30H,16-27,31-33H2,1-3H3 |
| InChIKey | GNNWKBUGWWZQGH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.08 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|