C19H23BrO5S — CID 118226132
2-[2-[2-(4-bromophenyl)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 118226132) has the molecular formula C19H23BrO5S and a molecular weight of 443.36 g/mol. Its IUPAC name is 2-[2-[2-(4-bromophenyl)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-(4-bromophenyl)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118226132 |
| Molecular Formula | C19H23BrO5S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[2-[2-(4-bromophenyl)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H23BrO5S/c1-16-2-8-19(9-3-16)26(21,22)25-15-14-24-13-12-23-11-10-17-4-6-18(20)7-5-17/h2-9H,10-15H2,1H3 |
| InChIKey | PXKJUYHCUYTFPI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|