C12H18N2O5S — CID 171517527
2-(2-methoxyethoxy)ethyl 4-methylbenzenesulfonate;molecular nitrogen (PubChem CID 171517527) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 4-methylbenzenesulfonate;molecular nitrogen.
| Compound Name | 2-(2-methoxyethoxy)ethyl 4-methylbenzenesulfonate;molecular nitrogen |
|---|---|
| PubChem CID | 171517527 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 4-methylbenzenesulfonate;molecular nitrogen |
| SMILES | COCCOCCOS(=O)(=O)c1ccc(C)cc1.N#N |
| InChI | InChI=1S/C12H18O5S.N2/c1-11-3-5-12(6-4-11)18(13,14)17-10-9-16-8-7-15-2;1-2/h3-6H,7-10H2,1-2H3; |
| InChIKey | JTHXCQVUPTVAIY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|