C12H15ClO5S — CID 156788750
2-(3-chloro-3-oxopropoxy)ethyl 4-methylbenzenesulfonate (PubChem CID 156788750) has the molecular formula C12H15ClO5S and a molecular weight of 306.77 g/mol. Its IUPAC name is 2-(3-chloro-3-oxopropoxy)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(3-chloro-3-oxopropoxy)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 156788750 |
| Molecular Formula | C12H15ClO5S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(3-chloro-3-oxopropoxy)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCC(=O)Cl)cc1 |
| InChI | InChI=1S/C12H15ClO5S/c1-10-2-4-11(5-3-10)19(15,16)18-9-8-17-7-6-12(13)14/h2-5H,6-9H2,1H3 |
| InChIKey | ITWUIENPJHGEOI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|