C20H26O7S2 — CID 3123163
2-[2-[2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 3123163) has the molecular formula C20H26O7S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[2-[2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3123163 |
| Molecular Formula | C20H26O7S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-[2-[2-(4-methylphenyl)sulfonylethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)CCOCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H26O7S2/c1-17-3-7-19(8-4-17)28(21,22)16-15-26-12-11-25-13-14-27-29(23,24)20-9-5-18(2)6-10-20/h3-10H,11-16H2,1-2H3 |
| InChIKey | OPFLOFGFHOOMEI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|