C29H44O10S4 — CID 23516613
2-[2-[2-[3-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylsulfanyl]propylsulfanyl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 23516613) has the molecular formula C29H44O10S4 and a molecular weight of 680.93 g/mol. Its IUPAC name is 2-[2-[2-[3-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylsulfanyl]propylsulfanyl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[3-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylsulfanyl]propylsulfanyl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23516613 |
| Molecular Formula | C29H44O10S4 |
| Molecular Weight | 680.93 g/mol |
| Exact Mass | 680.18 |
| IUPAC Name | 2-[2-[2-[3-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethylsulfanyl]propylsulfanyl]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCSCCCSCCOCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H44O10S4/c1-26-4-8-28(9-5-26)42(30,31)38-18-16-34-12-14-36-20-24-40-22-3-23-41-25-21-37-15-13-35-17-19-39-43(32,33)29-10-6-27(2)7-11-29/h4-11H,3,12-25H2,1-2H3 |
| InChIKey | XGEGHPLHEDYEGO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.93 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|