C14H22O5S — CID 139845279
3-(2-ethoxyethoxy)propyl 4-methylbenzenesulfonate (PubChem CID 139845279) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)propyl 4-methylbenzenesulfonate.
| Compound Name | 3-(2-ethoxyethoxy)propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139845279 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(2-ethoxyethoxy)propyl 4-methylbenzenesulfonate |
| SMILES | CCOCCOCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H22O5S/c1-3-17-11-12-18-9-4-10-19-20(15,16)14-7-5-13(2)6-8-14/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | PLADUIVGGKJINP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|