C15H20F6O5S — CID 159576980
2-ethoxy-1,1,1-trifluoroethane;2-(2,2,2-trifluoroethoxy)ethyl 4-methylbenzenesulfonate (PubChem CID 159576980) has the molecular formula C15H20F6O5S and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-ethoxy-1,1,1-trifluoroethane;2-(2,2,2-trifluoroethoxy)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-ethoxy-1,1,1-trifluoroethane;2-(2,2,2-trifluoroethoxy)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 159576980 |
| Molecular Formula | C15H20F6O5S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-ethoxy-1,1,1-trifluoroethane;2-(2,2,2-trifluoroethoxy)ethyl 4-methylbenzenesulfonate |
| SMILES | CCOCC(F)(F)F.Cc1ccc(S(=O)(=O)OCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3O4S.C4H7F3O/c1-9-2-4-10(5-3-9)19(15,16)18-7-6-17-8-11(12,13)14;1-2-8-3-4(5,6)7/h2-5H,6-8H2,1H3;2-3H2,1H3 |
| InChIKey | MINMWIIBARKNEU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|