C19H22F10O8S — CID 135196028
2-[2-[2-[(1,1-difluoro-2-propoxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 135196028) has the molecular formula C19H22F10O8S and a molecular weight of 600.42 g/mol. Its IUPAC name is 2-[2-[2-[(1,1-difluoro-2-propoxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[(1,1-difluoro-2-propoxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135196028 |
| Molecular Formula | C19H22F10O8S |
| Molecular Weight | 600.42 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | 2-[2-[2-[(1,1-difluoro-2-propoxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CCCOCC(F)(F)OC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22F10O8S/c1-3-8-32-12-16(22,23)36-19(28,29)37-18(26,27)17(24,25)35-15(20,21)11-33-9-10-34-38(30,31)14-6-4-13(2)5-7-14/h4-7H,3,8-12H2,1-2H3 |
| InChIKey | PRAXZSMBJILGDZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|