C14H22O5S — CID 86645449
2-(3-hydroxy-3-methylbutoxy)ethyl 4-methylbenzenesulfonate (PubChem CID 86645449) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylbutoxy)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(3-hydroxy-3-methylbutoxy)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86645449 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(3-hydroxy-3-methylbutoxy)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCC(C)(C)O)cc1 |
| InChI | InChI=1S/C14H22O5S/c1-12-4-6-13(7-5-12)20(16,17)19-11-10-18-9-8-14(2,3)15/h4-7,15H,8-11H2,1-3H3 |
| InChIKey | SBJJQGAUEDJRJS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|