C25H37BrO6S — CID 160653771
4-(4-bromo-3,5-dimethylphenoxy)-2-methylbutan-2-ol;(3-hydroxy-3-methylbutyl) 4-methylbenzenesulfonate (PubChem CID 160653771) has the molecular formula C25H37BrO6S and a molecular weight of 545.54 g/mol. Its IUPAC name is 4-(4-bromo-3,5-dimethylphenoxy)-2-methylbutan-2-ol;(3-hydroxy-3-methylbutyl) 4-methylbenzenesulfonate.
| Compound Name | 4-(4-bromo-3,5-dimethylphenoxy)-2-methylbutan-2-ol;(3-hydroxy-3-methylbutyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 160653771 |
| Molecular Formula | C25H37BrO6S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 4-(4-bromo-3,5-dimethylphenoxy)-2-methylbutan-2-ol;(3-hydroxy-3-methylbutyl) 4-methylbenzenesulfonate |
| SMILES | Cc1cc(OCCC(C)(C)O)cc(C)c1Br.Cc1ccc(S(=O)(=O)OCCC(C)(C)O)cc1 |
| InChI | InChI=1S/C13H19BrO2.C12H18O4S/c1-9-7-11(8-10(2)12(9)14)16-6-5-13(3,4)15;1-10-4-6-11(7-5-10)17(14,15)16-9-8-12(2,3)13/h7-8,15H,5-6H2,1-4H3;4-7,13H,8-9H2,1-3H3 |
| InChIKey | RKTRYSMZUXGIAV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|