C15H16Br2N2O3S — CID 14349846
[2-(3,6-dibromopyridazin-4-yl)-2-methylpropyl] 4-methylbenzenesulfonate (PubChem CID 14349846) has the molecular formula C15H16Br2N2O3S and a molecular weight of 464.18 g/mol. Its IUPAC name is [2-(3,6-dibromopyridazin-4-yl)-2-methylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(3,6-dibromopyridazin-4-yl)-2-methylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14349846 |
| Molecular Formula | C15H16Br2N2O3S |
| Molecular Weight | 464.18 g/mol |
| Exact Mass | 461.92 |
| IUPAC Name | [2-(3,6-dibromopyridazin-4-yl)-2-methylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)c2cc(Br)nnc2Br)cc1 |
| InChI | InChI=1S/C15H16Br2N2O3S/c1-10-4-6-11(7-5-10)23(20,21)22-9-15(2,3)12-8-13(16)18-19-14(12)17/h4-8H,9H2,1-3H3 |
| InChIKey | OJVIQGDURVHSJN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|