C16H15BrCl2O3S — CID 102436962
[2-(3,4-dichlorophenyl)-2-methylpropyl] 4-bromobenzenesulfonate (PubChem CID 102436962) has the molecular formula C16H15BrCl2O3S and a molecular weight of 438.17 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-methylpropyl] 4-bromobenzenesulfonate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-methylpropyl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 102436962 |
| Molecular Formula | C16H15BrCl2O3S |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 435.93 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-methylpropyl] 4-bromobenzenesulfonate |
| SMILES | CC(C)(COS(=O)(=O)c1ccc(Br)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15BrCl2O3S/c1-16(2,11-3-8-14(18)15(19)9-11)10-22-23(20,21)13-6-4-12(17)5-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | SJBMCRVVUYEQOR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|