C11H11Cl2NO — CID 82085338
1,2-dichloro-4-(1-isocyanato-2-methylpropan-2-yl)benzene (PubChem CID 82085338) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is 1,2-dichloro-4-(1-isocyanato-2-methylpropan-2-yl)benzene.
| Compound Name | 1,2-dichloro-4-(1-isocyanato-2-methylpropan-2-yl)benzene |
|---|---|
| PubChem CID | 82085338 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 1,2-dichloro-4-(1-isocyanato-2-methylpropan-2-yl)benzene |
| SMILES | CC(C)(CN=C=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO/c1-11(2,6-14-7-15)8-3-4-9(12)10(13)5-8/h3-5H,6H2,1-2H3 |
| InChIKey | RWLYPMSBIJHZKZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|