C20H27BrO3SSi — CID 15448898
[3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate (PubChem CID 15448898) has the molecular formula C20H27BrO3SSi and a molecular weight of 455.49 g/mol. Its IUPAC name is [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate.
| Compound Name | [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 15448898 |
| Molecular Formula | C20H27BrO3SSi |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
| SMILES | Cc1cccc([Si](C)(C)CC(C)(C)COS(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H27BrO3SSi/c1-16-7-6-8-19(13-16)26(4,5)15-20(2,3)14-24-25(22,23)18-11-9-17(21)10-12-18/h6-13H,14-15H2,1-5H3 |
| InChIKey | AGLVJDOGGADYBO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|