About [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate
[3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate (PubChem CID 15448898) has the molecular formula C20H27BrO3SSi
and a molecular weight of 455.49 g/mol. Its IUPAC name is [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
| PubChem CID | 15448898 |
| Molecular Formula | C20H27BrO3SSi |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
| SMILES | Cc1cccc([Si](C)(C)CC(C)(C)COS(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H27BrO3SSi/c1-16-7-6-8-19(13-16)26(4,5)15-20(2,3)14-24-25(22,23)18-11-9-17(21)10-12-18/h6-13H,14-15H2,1-5H3 |
| InChIKey | AGLVJDOGGADYBO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate?
The IUPAC name of [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate (CID 15448898) is [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate.
What is the SMILES notation for [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate?
The canonical SMILES for [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate is Cc1cccc([Si](C)(C)CC(C)(C)COS(=O)(=O)c2ccc(Br)cc2)c1.
What is the InChIKey of [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate?
The InChIKey is AGLVJDOGGADYBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27BrO3SSi/c1-16-7-6-8-19(13-16)26(4,5)15-20(2,3)14-24-25(22,23)18-11-9-17(21)10-12-18/h6-13H,14-15H2,1-5H3.
What are the key properties of [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate?
[3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate has a molecular weight of 455.49 g/mol, XLogP of 5.10, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[dimethyl-(3-methylphenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate is sourced from PubChem (CID 15448898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).