C19H25BrO3SSi — CID 15448899
[3-[dimethyl(phenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate (PubChem CID 15448899) has the molecular formula C19H25BrO3SSi and a molecular weight of 441.46 g/mol. Its IUPAC name is [3-[dimethyl(phenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate.
| Compound Name | [3-[dimethyl(phenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 15448899 |
| Molecular Formula | C19H25BrO3SSi |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | [3-[dimethyl(phenyl)silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
| SMILES | CC(C)(COS(=O)(=O)c1ccc(Br)cc1)C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H25BrO3SSi/c1-19(2,15-25(3,4)18-8-6-5-7-9-18)14-23-24(21,22)17-12-10-16(20)11-13-17/h5-13H,14-15H2,1-4H3 |
| InChIKey | GUYDJNISSBDDDO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|