C20H24BrF3O3SSi — CID 15448902
[3-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate (PubChem CID 15448902) has the molecular formula C20H24BrF3O3SSi and a molecular weight of 509.46 g/mol. Its IUPAC name is [3-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate.
| Compound Name | [3-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 15448902 |
| Molecular Formula | C20H24BrF3O3SSi |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | [3-[dimethyl-[4-(trifluoromethyl)phenyl]silyl]-2,2-dimethylpropyl] 4-bromobenzenesulfonate |
| SMILES | CC(C)(COS(=O)(=O)c1ccc(Br)cc1)C[Si](C)(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H24BrF3O3SSi/c1-19(2,13-27-28(25,26)17-9-7-16(21)8-10-17)14-29(3,4)18-11-5-15(6-12-18)20(22,23)24/h5-12H,13-14H2,1-4H3 |
| InChIKey | BRNAZADMWDABNW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|