C30H50O6S2Si2 — CID 89440328
[ditert-butyl-[ditert-butyl-(4-methylphenyl)sulfonyloxysilyl]silyl] 4-methylbenzenesulfonate (PubChem CID 89440328) has the molecular formula C30H50O6S2Si2 and a molecular weight of 627.03 g/mol. Its IUPAC name is [ditert-butyl-[ditert-butyl-(4-methylphenyl)sulfonyloxysilyl]silyl] 4-methylbenzenesulfonate.
| Compound Name | [ditert-butyl-[ditert-butyl-(4-methylphenyl)sulfonyloxysilyl]silyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89440328 |
| Molecular Formula | C30H50O6S2Si2 |
| Molecular Weight | 627.03 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | [ditert-butyl-[ditert-butyl-(4-methylphenyl)sulfonyloxysilyl]silyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[Si](C(C)(C)C)(C(C)(C)C)[Si](OS(=O)(=O)c2ccc(C)cc2)(C(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H50O6S2Si2/c1-23-15-19-25(20-16-23)37(31,32)35-39(27(3,4)5,28(6,7)8)40(29(9,10)11,30(12,13)14)36-38(33,34)26-21-17-24(2)18-22-26/h15-22H,1-14H3 |
| InChIKey | YTACGEGUBJEMPX-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.03 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|