About perchloryl 4-methylbenzenesulfonate
perchloryl 4-methylbenzenesulfonate (PubChem CID 87266305) has the molecular formula C7H7ClO6S
and a molecular weight of 254.65 g/mol. Its IUPAC name is perchloryl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | perchloryl 4-methylbenzenesulfonate |
| PubChem CID | 87266305 |
| Molecular Formula | C7H7ClO6S |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | perchloryl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[Cl+3]([O-])([O-])[O-])cc1 |
| InChI | InChI=1S/C7H7ClO6S/c1-6-2-4-7(5-3-6)15(12,13)14-8(9,10)11/h2-5H,1H3 |
| InChIKey | OIDNSVRVHYBLBR-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 112.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze perchloryl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perchloryl 4-methylbenzenesulfonate?
The IUPAC name of perchloryl 4-methylbenzenesulfonate (CID 87266305) is perchloryl 4-methylbenzenesulfonate.
What is the SMILES notation for perchloryl 4-methylbenzenesulfonate?
The canonical SMILES for perchloryl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O[Cl+3]([O-])([O-])[O-])cc1.
What is the InChIKey of perchloryl 4-methylbenzenesulfonate?
The InChIKey is OIDNSVRVHYBLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO6S/c1-6-2-4-7(5-3-6)15(12,13)14-8(9,10)11/h2-5H,1H3.
What are the key properties of perchloryl 4-methylbenzenesulfonate?
perchloryl 4-methylbenzenesulfonate has a molecular weight of 254.65 g/mol, XLogP of -2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for perchloryl 4-methylbenzenesulfonate is sourced from PubChem (CID 87266305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).