About bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate
bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate (PubChem CID 16703717) has the molecular formula C21H21O9S3Sb
and a molecular weight of 635.35 g/mol. Its IUPAC name is bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate |
| PubChem CID | 16703717 |
| Molecular Formula | C21H21O9S3Sb |
| Molecular Weight | 635.35 g/mol |
| Exact Mass | 633.94 |
| IUPAC Name | bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[Sb](OS(=O)(=O)c2ccc(C)cc2)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/3C7H8O3S.Sb/c3*1-6-2-4-7(5-3-6)11(8,9)10;/h3*2-5H,1H3,(H,8,9,10);/q;;;+3/p-3 |
| InChIKey | SHXXPUOHIKESCB-UHFFFAOYSA-K |
| XLogP | 3.11 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 635.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate?
The IUPAC name of bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate (CID 16703717) is bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate.
What is the SMILES notation for bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate?
The canonical SMILES for bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)O[Sb](OS(=O)(=O)c2ccc(C)cc2)OS(=O)(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate?
The InChIKey is SHXXPUOHIKESCB-UHFFFAOYSA-K. The full InChI is InChI=1S/3C7H8O3S.Sb/c3*1-6-2-4-7(5-3-6)11(8,9)10;/h3*2-5H,1H3,(H,8,9,10);/q;;;+3/p-3.
What are the key properties of bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate?
bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate has a molecular weight of 635.35 g/mol, XLogP of 3.11, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis-(4-methylphenyl)sulfonyloxystibanyl 4-methylbenzenesulfonate is sourced from PubChem (CID 16703717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).