About (methoxyamino) 4-methylbenzenesulfonate
(methoxyamino) 4-methylbenzenesulfonate (PubChem CID 175159749) has the molecular formula C8H11NO4S
and a molecular weight of 217.25 g/mol. Its IUPAC name is (methoxyamino) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (methoxyamino) 4-methylbenzenesulfonate |
| PubChem CID | 175159749 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (methoxyamino) 4-methylbenzenesulfonate |
| SMILES | CONOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C8H11NO4S/c1-7-3-5-8(6-4-7)14(10,11)13-9-12-2/h3-6,9H,1-2H3 |
| InChIKey | LJDBWJYDVPDBFE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (methoxyamino) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (methoxyamino) 4-methylbenzenesulfonate?
The IUPAC name of (methoxyamino) 4-methylbenzenesulfonate (CID 175159749) is (methoxyamino) 4-methylbenzenesulfonate.
What is the SMILES notation for (methoxyamino) 4-methylbenzenesulfonate?
The canonical SMILES for (methoxyamino) 4-methylbenzenesulfonate is CONOS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of (methoxyamino) 4-methylbenzenesulfonate?
The InChIKey is LJDBWJYDVPDBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4S/c1-7-3-5-8(6-4-7)14(10,11)13-9-12-2/h3-6,9H,1-2H3.
What are the key properties of (methoxyamino) 4-methylbenzenesulfonate?
(methoxyamino) 4-methylbenzenesulfonate has a molecular weight of 217.25 g/mol, XLogP of 0.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (methoxyamino) 4-methylbenzenesulfonate is sourced from PubChem (CID 175159749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).