About (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate
(2-tert-butylhydrazinyl) 4-methylbenzenesulfonate (PubChem CID 57039564) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate |
| PubChem CID | 57039564 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ONNC(C)(C)C)cc1 |
| InChI | InChI=1S/C11H18N2O3S/c1-9-5-7-10(8-6-9)17(14,15)16-13-12-11(2,3)4/h5-8,12-13H,1-4H3 |
| InChIKey | LDRGMGWTVZLWOH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate?
The IUPAC name of (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate (CID 57039564) is (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate.
What is the SMILES notation for (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate?
The canonical SMILES for (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)ONNC(C)(C)C)cc1.
What is the InChIKey of (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate?
The InChIKey is LDRGMGWTVZLWOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S/c1-9-5-7-10(8-6-9)17(14,15)16-13-12-11(2,3)4/h5-8,12-13H,1-4H3.
What are the key properties of (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate?
(2-tert-butylhydrazinyl) 4-methylbenzenesulfonate has a molecular weight of 258.34 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylhydrazinyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 57039564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).